C16H19ClN6O — CID 133281186
5-chloro-6-[methyl-(1-pyridazin-3-ylpiperidin-3-yl)amino]pyridine-3-carboxamide (PubChem CID 133281186) has the molecular formula C16H19ClN6O and a molecular weight of 346.82 g/mol. Its IUPAC name is 5-chloro-6-[methyl-(1-pyridazin-3-ylpiperidin-3-yl)amino]pyridine-3-carboxamide.
| Compound Name | 5-chloro-6-[methyl-(1-pyridazin-3-ylpiperidin-3-yl)amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 133281186 |
| Molecular Formula | C16H19ClN6O |
| Molecular Weight | 346.82 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 5-chloro-6-[methyl-(1-pyridazin-3-ylpiperidin-3-yl)amino]pyridine-3-carboxamide |
| SMILES | CN(c1ncc(C(N)=O)cc1Cl)C1CCCN(c2cccnn2)C1 |
| InChI | InChI=1S/C16H19ClN6O/c1-22(16-13(17)8-11(9-19-16)15(18)24)12-4-3-7-23(10-12)14-5-2-6-20-21-14/h2,5-6,8-9,12H,3-4,7,10H2,1H3,(H2,18,24) |
| InChIKey | VASBLIHYAHZKHE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.82 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |