C19H20ClN5 — CID 133281180
7-chloro-N-methyl-N-(1-pyridazin-3-ylpiperidin-3-yl)quinolin-4-amine (PubChem CID 133281180) has the molecular formula C19H20ClN5 and a molecular weight of 353.86 g/mol. Its IUPAC name is 7-chloro-N-methyl-N-(1-pyridazin-3-ylpiperidin-3-yl)quinolin-4-amine.
| Compound Name | 7-chloro-N-methyl-N-(1-pyridazin-3-ylpiperidin-3-yl)quinolin-4-amine |
|---|---|
| PubChem CID | 133281180 |
| Molecular Formula | C19H20ClN5 |
| Molecular Weight | 353.86 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 7-chloro-N-methyl-N-(1-pyridazin-3-ylpiperidin-3-yl)quinolin-4-amine |
| SMILES | CN(c1ccnc2cc(Cl)ccc12)C1CCCN(c2cccnn2)C1 |
| InChI | InChI=1S/C19H20ClN5/c1-24(18-8-10-21-17-12-14(20)6-7-16(17)18)15-4-3-11-25(13-15)19-5-2-9-22-23-19/h2,5-10,12,15H,3-4,11,13H2,1H3 |
| InChIKey | ITRGDSJCFMONQP-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.86 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |