C22H25N7O2 — CID 133281141
6-ethyl-N-methyl-2-(4-nitrophenyl)-N-(1-pyridazin-3-ylpiperidin-3-yl)pyrimidin-4-amine (PubChem CID 133281141) has the molecular formula C22H25N7O2 and a molecular weight of 419.49 g/mol. Its IUPAC name is 6-ethyl-N-methyl-2-(4-nitrophenyl)-N-(1-pyridazin-3-ylpiperidin-3-yl)pyrimidin-4-amine.
| Compound Name | 6-ethyl-N-methyl-2-(4-nitrophenyl)-N-(1-pyridazin-3-ylpiperidin-3-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 133281141 |
| Molecular Formula | C22H25N7O2 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 6-ethyl-N-methyl-2-(4-nitrophenyl)-N-(1-pyridazin-3-ylpiperidin-3-yl)pyrimidin-4-amine |
| SMILES | CCc1cc(N(C)C2CCCN(c3cccnn3)C2)nc(-c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C22H25N7O2/c1-3-17-14-21(25-22(24-17)16-8-10-18(11-9-16)29(30)31)27(2)19-6-5-13-28(15-19)20-7-4-12-23-26-20/h4,7-12,14,19H,3,5-6,13,15H2,1-2H3 |
| InChIKey | QLOOLRWNXTZMPN-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 101.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|