C16H16N6 — CID 133284481
3-[2-(1-ethylbenzimidazol-2-yl)ethylamino]pyrazine-2-carbonitrile (PubChem CID 133284481) has the molecular formula C16H16N6 and a molecular weight of 292.35 g/mol. Its IUPAC name is 3-[2-(1-ethylbenzimidazol-2-yl)ethylamino]pyrazine-2-carbonitrile.
| Compound Name | 3-[2-(1-ethylbenzimidazol-2-yl)ethylamino]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 133284481 |
| Molecular Formula | C16H16N6 |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 3-[2-(1-ethylbenzimidazol-2-yl)ethylamino]pyrazine-2-carbonitrile |
| SMILES | CCn1c(CCNc2nccnc2C#N)nc2ccccc21 |
| InChI | InChI=1S/C16H16N6/c1-2-22-14-6-4-3-5-12(14)21-15(22)7-8-19-16-13(11-17)18-9-10-20-16/h3-6,9-10H,2,7-8H2,1H3,(H,19,20) |
| InChIKey | LPBSBMWWKDYSDZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |