C18H21N5 — CID 133304089
2-cyclopropyl-N-[2-(1-ethylbenzimidazol-2-yl)ethyl]pyrimidin-4-amine (PubChem CID 133304089) has the molecular formula C18H21N5 and a molecular weight of 307.40 g/mol. Its IUPAC name is 2-cyclopropyl-N-[2-(1-ethylbenzimidazol-2-yl)ethyl]pyrimidin-4-amine.
| Compound Name | 2-cyclopropyl-N-[2-(1-ethylbenzimidazol-2-yl)ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 133304089 |
| Molecular Formula | C18H21N5 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 2-cyclopropyl-N-[2-(1-ethylbenzimidazol-2-yl)ethyl]pyrimidin-4-amine |
| SMILES | CCn1c(CCNc2ccnc(C3CC3)n2)nc2ccccc21 |
| InChI | InChI=1S/C18H21N5/c1-2-23-15-6-4-3-5-14(15)21-17(23)10-12-19-16-9-11-20-18(22-16)13-7-8-13/h3-6,9,11,13H,2,7-8,10,12H2,1H3,(H,19,20,22) |
| InChIKey | FGHLCVWIEUFLNU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |