C18H22N6 — CID 144628437
2-cyclopropyl-1-methylbenzimidazole;(2-cyclopropylpyrimidin-4-yl)hydrazine (PubChem CID 144628437) has the molecular formula C18H22N6 and a molecular weight of 322.42 g/mol. Its IUPAC name is 2-cyclopropyl-1-methylbenzimidazole;(2-cyclopropylpyrimidin-4-yl)hydrazine.
| Compound Name | 2-cyclopropyl-1-methylbenzimidazole;(2-cyclopropylpyrimidin-4-yl)hydrazine |
|---|---|
| PubChem CID | 144628437 |
| Molecular Formula | C18H22N6 |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 2-cyclopropyl-1-methylbenzimidazole;(2-cyclopropylpyrimidin-4-yl)hydrazine |
| SMILES | Cn1c(C2CC2)nc2ccccc21.NNc1ccnc(C2CC2)n1 |
| InChI | InChI=1S/C11H12N2.C7H10N4/c1-13-10-5-3-2-4-9(10)12-11(13)8-6-7-8;8-11-6-3-4-9-7(10-6)5-1-2-5/h2-5,8H,6-7H2,1H3;3-5H,1-2,8H2,(H,9,10,11) |
| InChIKey | LEANRQBMRFVIHA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|