C18H20N6 — CID 90166375
[2-cyclopropyl-6-[(1R,2R)-2-(1-methylbenzimidazol-2-yl)cyclopropyl]pyrimidin-4-yl]hydrazine (PubChem CID 90166375) has the molecular formula C18H20N6 and a molecular weight of 320.40 g/mol. Its IUPAC name is [2-cyclopropyl-6-[(1R,2R)-2-(1-methylbenzimidazol-2-yl)cyclopropyl]pyrimidin-4-yl]hydrazine.
| Compound Name | [2-cyclopropyl-6-[(1R,2R)-2-(1-methylbenzimidazol-2-yl)cyclopropyl]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 90166375 |
| Molecular Formula | C18H20N6 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | [2-cyclopropyl-6-[(1R,2R)-2-(1-methylbenzimidazol-2-yl)cyclopropyl]pyrimidin-4-yl]hydrazine |
| SMILES | Cn1c([C@@H]2C[C@H]2c2cc(NN)nc(C3CC3)n2)nc2ccccc21 |
| InChI | InChI=1S/C18H20N6/c1-24-15-5-3-2-4-13(15)21-18(24)12-8-11(12)14-9-16(23-19)22-17(20-14)10-6-7-10/h2-5,9-12H,6-8,19H2,1H3,(H,20,22,23)/t11-,12-/m1/s1 |
| InChIKey | HDCDQXNOKZXHBP-VXGBXAGGSA-N |
| XLogP | 2.80 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|