About [2-methoxy-6-[(1R,2R)-2-(1-methylbenzimidazol-2-yl)cyclopropyl]pyrimidin-4-yl]hydrazine
[2-methoxy-6-[(1R,2R)-2-(1-methylbenzimidazol-2-yl)cyclopropyl]pyrimidin-4-yl]hydrazine (PubChem CID 90166372) has the molecular formula C16H18N6O
and a molecular weight of 310.36 g/mol. Its IUPAC name is [2-methoxy-6-[(1R,2R)-2-(1-methylbenzimidazol-2-yl)cyclopropyl]pyrimidin-4-yl]hydrazine.
Molecular Properties
| Compound Name | [2-methoxy-6-[(1R,2R)-2-(1-methylbenzimidazol-2-yl)cyclopropyl]pyrimidin-4-yl]hydrazine |
| PubChem CID | 90166372 |
| Molecular Formula | C16H18N6O |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | [2-methoxy-6-[(1R,2R)-2-(1-methylbenzimidazol-2-yl)cyclopropyl]pyrimidin-4-yl]hydrazine |
| SMILES | COc1nc(NN)cc([C@@H]2C[C@H]2c2nc3ccccc3n2C)n1 |
| InChI | InChI=1S/C16H18N6O/c1-22-13-6-4-3-5-11(13)18-15(22)10-7-9(10)12-8-14(21-17)20-16(19-12)23-2/h3-6,8-10H,7,17H2,1-2H3,(H,19,20,21)/t9-,10-/m1/s1 |
| InChIKey | KROPHANKCNVKSH-NXEZZACHSA-N |
| XLogP | 1.93 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-methoxy-6-[(1R,2R)-2-(1-methylbenzimidazol-2-yl)cyclopropyl]pyrimidin-4-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-methoxy-6-[(1R,2R)-2-(1-methylbenzimidazol-2-yl)cyclopropyl]pyrimidin-4-yl]hydrazine?
The IUPAC name of [2-methoxy-6-[(1R,2R)-2-(1-methylbenzimidazol-2-yl)cyclopropyl]pyrimidin-4-yl]hydrazine (CID 90166372) is [2-methoxy-6-[(1R,2R)-2-(1-methylbenzimidazol-2-yl)cyclopropyl]pyrimidin-4-yl]hydrazine.
What is the SMILES notation for [2-methoxy-6-[(1R,2R)-2-(1-methylbenzimidazol-2-yl)cyclopropyl]pyrimidin-4-yl]hydrazine?
The canonical SMILES for [2-methoxy-6-[(1R,2R)-2-(1-methylbenzimidazol-2-yl)cyclopropyl]pyrimidin-4-yl]hydrazine is COc1nc(NN)cc([C@@H]2C[C@H]2c2nc3ccccc3n2C)n1.
What is the InChIKey of [2-methoxy-6-[(1R,2R)-2-(1-methylbenzimidazol-2-yl)cyclopropyl]pyrimidin-4-yl]hydrazine?
The InChIKey is KROPHANKCNVKSH-NXEZZACHSA-N. The full InChI is InChI=1S/C16H18N6O/c1-22-13-6-4-3-5-11(13)18-15(22)10-7-9(10)12-8-14(21-17)20-16(19-12)23-2/h3-6,8-10H,7,17H2,1-2H3,(H,19,20,21)/t9-,10-/m1/s1.
What are the key properties of [2-methoxy-6-[(1R,2R)-2-(1-methylbenzimidazol-2-yl)cyclopropyl]pyrimidin-4-yl]hydrazine?
[2-methoxy-6-[(1R,2R)-2-(1-methylbenzimidazol-2-yl)cyclopropyl]pyrimidin-4-yl]hydrazine has a molecular weight of 310.36 g/mol, XLogP of 1.93, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-methoxy-6-[(1R,2R)-2-(1-methylbenzimidazol-2-yl)cyclopropyl]pyrimidin-4-yl]hydrazine is sourced from PubChem (CID 90166372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).