C19H20ClN3O2S — CID 133286018
2-[[1-(benzenesulfonyl)piperidin-4-yl]methylamino]-5-chlorobenzonitrile (PubChem CID 133286018) has the molecular formula C19H20ClN3O2S and a molecular weight of 389.91 g/mol. Its IUPAC name is 2-[[1-(benzenesulfonyl)piperidin-4-yl]methylamino]-5-chlorobenzonitrile.
| Compound Name | 2-[[1-(benzenesulfonyl)piperidin-4-yl]methylamino]-5-chlorobenzonitrile |
|---|---|
| PubChem CID | 133286018 |
| Molecular Formula | C19H20ClN3O2S |
| Molecular Weight | 389.91 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 2-[[1-(benzenesulfonyl)piperidin-4-yl]methylamino]-5-chlorobenzonitrile |
| SMILES | N#Cc1cc(Cl)ccc1NCC1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C19H20ClN3O2S/c20-17-6-7-19(16(12-17)13-21)22-14-15-8-10-23(11-9-15)26(24,25)18-4-2-1-3-5-18/h1-7,12,15,22H,8-11,14H2 |
| InChIKey | KAJNBWYVTCMUEA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.91 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |