C13H11N5O2 — CID 133288348
3-nitro-4-(1,4,6,7-tetrahydropyrazolo[4,5-c]pyridin-5-yl)benzonitrile (PubChem CID 133288348) has the molecular formula C13H11N5O2 and a molecular weight of 269.26 g/mol. Its IUPAC name is 3-nitro-4-(1,4,6,7-tetrahydropyrazolo[4,5-c]pyridin-5-yl)benzonitrile.
| Compound Name | 3-nitro-4-(1,4,6,7-tetrahydropyrazolo[4,5-c]pyridin-5-yl)benzonitrile |
|---|---|
| PubChem CID | 133288348 |
| Molecular Formula | C13H11N5O2 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 3-nitro-4-(1,4,6,7-tetrahydropyrazolo[4,5-c]pyridin-5-yl)benzonitrile |
| SMILES | N#Cc1ccc(N2CCc3[nH]ncc3C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H11N5O2/c14-6-9-1-2-12(13(5-9)18(19)20)17-4-3-11-10(8-17)7-15-16-11/h1-2,5,7H,3-4,8H2,(H,15,16) |
| InChIKey | PTXRMWXJBYYTBL-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|