C15H11N5O2S — CID 46663248
2-amino-6-(4-cyano-2-nitrophenyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carbonitrile (PubChem CID 46663248) has the molecular formula C15H11N5O2S and a molecular weight of 325.35 g/mol. Its IUPAC name is 2-amino-6-(4-cyano-2-nitrophenyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carbonitrile.
| Compound Name | 2-amino-6-(4-cyano-2-nitrophenyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 46663248 |
| Molecular Formula | C15H11N5O2S |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 2-amino-6-(4-cyano-2-nitrophenyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(N2CCc3c(sc(N)c3C#N)C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H11N5O2S/c16-6-9-1-2-12(13(5-9)20(21)22)19-4-3-10-11(7-17)15(18)23-14(10)8-19/h1-2,5H,3-4,8,18H2 |
| InChIKey | PLCSYYWCRVCCJM-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 119.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|