C20H17ClFN3O — CID 133289781
2-(2-chlorophenyl)-4-[6-(4-fluorophenyl)pyridazin-3-yl]morpholine (PubChem CID 133289781) has the molecular formula C20H17ClFN3O and a molecular weight of 369.83 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-4-[6-(4-fluorophenyl)pyridazin-3-yl]morpholine.
| Compound Name | 2-(2-chlorophenyl)-4-[6-(4-fluorophenyl)pyridazin-3-yl]morpholine |
|---|---|
| PubChem CID | 133289781 |
| Molecular Formula | C20H17ClFN3O |
| Molecular Weight | 369.83 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 2-(2-chlorophenyl)-4-[6-(4-fluorophenyl)pyridazin-3-yl]morpholine |
| SMILES | Fc1ccc(-c2ccc(N3CCOC(c4ccccc4Cl)C3)nn2)cc1 |
| InChI | InChI=1S/C20H17ClFN3O/c21-17-4-2-1-3-16(17)19-13-25(11-12-26-19)20-10-9-18(23-24-20)14-5-7-15(22)8-6-14/h1-10,19H,11-13H2 |
| InChIKey | LBQODARUXFEUMO-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.83 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |