C19H23FN4 — CID 133292234
N-(1-cyclopentylpyrrolidin-3-yl)-6-(4-fluorophenyl)pyridazin-3-amine (PubChem CID 133292234) has the molecular formula C19H23FN4 and a molecular weight of 326.42 g/mol. Its IUPAC name is N-(1-cyclopentylpyrrolidin-3-yl)-6-(4-fluorophenyl)pyridazin-3-amine.
| Compound Name | N-(1-cyclopentylpyrrolidin-3-yl)-6-(4-fluorophenyl)pyridazin-3-amine |
|---|---|
| PubChem CID | 133292234 |
| Molecular Formula | C19H23FN4 |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | N-(1-cyclopentylpyrrolidin-3-yl)-6-(4-fluorophenyl)pyridazin-3-amine |
| SMILES | Fc1ccc(-c2ccc(NC3CCN(C4CCCC4)C3)nn2)cc1 |
| InChI | InChI=1S/C19H23FN4/c20-15-7-5-14(6-8-15)18-9-10-19(23-22-18)21-16-11-12-24(13-16)17-3-1-2-4-17/h5-10,16-17H,1-4,11-13H2,(H,21,23) |
| InChIKey | IHKHCGPDJYCSHE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |