C24H31ClIN5 — CID 71043230
1-[6-(3-chloro-4-iodophenyl)pyridazin-3-yl]-N-[(3R)-1-cyclopentylpyrrolidin-3-yl]piperidin-4-amine (PubChem CID 71043230) has the molecular formula C24H31ClIN5 and a molecular weight of 551.90 g/mol. Its IUPAC name is 1-[6-(3-chloro-4-iodophenyl)pyridazin-3-yl]-N-[(3R)-1-cyclopentylpyrrolidin-3-yl]piperidin-4-amine.
| Compound Name | 1-[6-(3-chloro-4-iodophenyl)pyridazin-3-yl]-N-[(3R)-1-cyclopentylpyrrolidin-3-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 71043230 |
| Molecular Formula | C24H31ClIN5 |
| Molecular Weight | 551.90 g/mol |
| Exact Mass | 551.13 |
| IUPAC Name | 1-[6-(3-chloro-4-iodophenyl)pyridazin-3-yl]-N-[(3R)-1-cyclopentylpyrrolidin-3-yl]piperidin-4-amine |
| SMILES | Clc1cc(-c2ccc(N3CCC(N[C@@H]4CCN(C5CCCC5)C4)CC3)nn2)ccc1I |
| InChI | InChI=1S/C24H31ClIN5/c25-21-15-17(5-6-22(21)26)23-7-8-24(29-28-23)30-12-9-18(10-13-30)27-19-11-14-31(16-19)20-3-1-2-4-20/h5-8,15,18-20,27H,1-4,9-14,16H2/t19-/m1/s1 |
| InChIKey | RHVHZNGFLMBDRB-LJQANCHMSA-N |
| XLogP | 4.98 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.90 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|