C18H21N3S — CID 133292561
N-[1-(4-tert-butyl-1,3-thiazol-2-yl)ethyl]quinolin-2-amine (PubChem CID 133292561) has the molecular formula C18H21N3S and a molecular weight of 311.45 g/mol. Its IUPAC name is N-[1-(4-tert-butyl-1,3-thiazol-2-yl)ethyl]quinolin-2-amine.
| Compound Name | N-[1-(4-tert-butyl-1,3-thiazol-2-yl)ethyl]quinolin-2-amine |
|---|---|
| PubChem CID | 133292561 |
| Molecular Formula | C18H21N3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | N-[1-(4-tert-butyl-1,3-thiazol-2-yl)ethyl]quinolin-2-amine |
| SMILES | CC(Nc1ccc2ccccc2n1)c1nc(C(C)(C)C)cs1 |
| InChI | InChI=1S/C18H21N3S/c1-12(17-21-15(11-22-17)18(2,3)4)19-16-10-9-13-7-5-6-8-14(13)20-16/h5-12H,1-4H3,(H,19,20) |
| InChIKey | QZYAGGMZOHQLJT-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |