C22H19ClFN5O — CID 133296334
4-[3-[(5-chloro-6-oxo-1-phenylpyridazin-4-yl)amino]piperidin-1-yl]-3-fluorobenzonitrile (PubChem CID 133296334) has the molecular formula C22H19ClFN5O and a molecular weight of 423.88 g/mol. Its IUPAC name is 4-[3-[(5-chloro-6-oxo-1-phenylpyridazin-4-yl)amino]piperidin-1-yl]-3-fluorobenzonitrile.
| Compound Name | 4-[3-[(5-chloro-6-oxo-1-phenylpyridazin-4-yl)amino]piperidin-1-yl]-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 133296334 |
| Molecular Formula | C22H19ClFN5O |
| Molecular Weight | 423.88 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 4-[3-[(5-chloro-6-oxo-1-phenylpyridazin-4-yl)amino]piperidin-1-yl]-3-fluorobenzonitrile |
| SMILES | N#Cc1ccc(N2CCCC(Nc3cnn(-c4ccccc4)c(=O)c3Cl)C2)c(F)c1 |
| InChI | InChI=1S/C22H19ClFN5O/c23-21-19(13-26-29(22(21)30)17-6-2-1-3-7-17)27-16-5-4-10-28(14-16)20-9-8-15(12-25)11-18(20)24/h1-3,6-9,11,13,16,27H,4-5,10,14H2 |
| InChIKey | XGNQLSVXCGMVJX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 73.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.88 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |