C19H21F3N4O — CID 133297396
2-cyclopropyl-N-[[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]methyl]pyrimidin-4-amine (PubChem CID 133297396) has the molecular formula C19H21F3N4O and a molecular weight of 378.40 g/mol. Its IUPAC name is 2-cyclopropyl-N-[[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]methyl]pyrimidin-4-amine.
| Compound Name | 2-cyclopropyl-N-[[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 133297396 |
| Molecular Formula | C19H21F3N4O |
| Molecular Weight | 378.40 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 2-cyclopropyl-N-[[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]methyl]pyrimidin-4-amine |
| SMILES | FC(F)(F)c1cc(N2CCOCC2)ccc1CNc1ccnc(C2CC2)n1 |
| InChI | InChI=1S/C19H21F3N4O/c20-19(21,22)16-11-15(26-7-9-27-10-8-26)4-3-14(16)12-24-17-5-6-23-18(25-17)13-1-2-13/h3-6,11,13H,1-2,7-10,12H2,(H,23,24,25) |
| InChIKey | KQKKLJYGMQYUIC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.40 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |