C17H17BrF3N3O — CID 133385182
N-[(4-bromo-2-morpholin-4-ylphenyl)methyl]-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 133385182) has the molecular formula C17H17BrF3N3O and a molecular weight of 416.24 g/mol. Its IUPAC name is N-[(4-bromo-2-morpholin-4-ylphenyl)methyl]-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[(4-bromo-2-morpholin-4-ylphenyl)methyl]-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 133385182 |
| Molecular Formula | C17H17BrF3N3O |
| Molecular Weight | 416.24 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | N-[(4-bromo-2-morpholin-4-ylphenyl)methyl]-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | FC(F)(F)c1ccnc(NCc2ccc(Br)cc2N2CCOCC2)c1 |
| InChI | InChI=1S/C17H17BrF3N3O/c18-14-2-1-12(15(10-14)24-5-7-25-8-6-24)11-23-16-9-13(3-4-22-16)17(19,20)21/h1-4,9-10H,5-8,11H2,(H,22,23) |
| InChIKey | FIDYGQGKXAJNOC-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.24 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |