C18H22Cl2N4O2 — CID 133298934
1-(2,3-dichlorophenoxy)-3-[(6-piperidin-1-ylpyrimidin-4-yl)amino]propan-2-ol (PubChem CID 133298934) has the molecular formula C18H22Cl2N4O2 and a molecular weight of 397.31 g/mol. Its IUPAC name is 1-(2,3-dichlorophenoxy)-3-[(6-piperidin-1-ylpyrimidin-4-yl)amino]propan-2-ol.
| Compound Name | 1-(2,3-dichlorophenoxy)-3-[(6-piperidin-1-ylpyrimidin-4-yl)amino]propan-2-ol |
|---|---|
| PubChem CID | 133298934 |
| Molecular Formula | C18H22Cl2N4O2 |
| Molecular Weight | 397.31 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 1-(2,3-dichlorophenoxy)-3-[(6-piperidin-1-ylpyrimidin-4-yl)amino]propan-2-ol |
| SMILES | OC(CNc1cc(N2CCCCC2)ncn1)COc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C18H22Cl2N4O2/c19-14-5-4-6-15(18(14)20)26-11-13(25)10-21-16-9-17(23-12-22-16)24-7-2-1-3-8-24/h4-6,9,12-13,25H,1-3,7-8,10-11H2,(H,21,22,23) |
| InChIKey | HJEQAMTVHMCKME-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.31 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |