C18H17N5 — CID 133299899
5-[(2-pyridin-4-ylquinazolin-4-yl)amino]pentanenitrile (PubChem CID 133299899) has the molecular formula C18H17N5 and a molecular weight of 303.37 g/mol. Its IUPAC name is 5-[(2-pyridin-4-ylquinazolin-4-yl)amino]pentanenitrile.
| Compound Name | 5-[(2-pyridin-4-ylquinazolin-4-yl)amino]pentanenitrile |
|---|---|
| PubChem CID | 133299899 |
| Molecular Formula | C18H17N5 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 5-[(2-pyridin-4-ylquinazolin-4-yl)amino]pentanenitrile |
| SMILES | N#CCCCCNc1nc(-c2ccncc2)nc2ccccc12 |
| InChI | InChI=1S/C18H17N5/c19-10-4-1-5-11-21-18-15-6-2-3-7-16(15)22-17(23-18)14-8-12-20-13-9-14/h2-3,6-9,12-13H,1,4-5,11H2,(H,21,22,23) |
| InChIKey | UJLCSLNKDGBHAB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|