C22H27N5 — CID 31581585
N-[3-[(2R)-2-methylpiperidin-1-yl]propyl]-2-pyridin-4-ylquinazolin-4-amine (PubChem CID 31581585) has the molecular formula C22H27N5 and a molecular weight of 361.49 g/mol. Its IUPAC name is N-[3-[(2R)-2-methylpiperidin-1-yl]propyl]-2-pyridin-4-ylquinazolin-4-amine.
| Compound Name | N-[3-[(2R)-2-methylpiperidin-1-yl]propyl]-2-pyridin-4-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 31581585 |
| Molecular Formula | C22H27N5 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | N-[3-[(2R)-2-methylpiperidin-1-yl]propyl]-2-pyridin-4-ylquinazolin-4-amine |
| SMILES | C[C@@H]1CCCCN1CCCNc1nc(-c2ccncc2)nc2ccccc12 |
| InChI | InChI=1S/C22H27N5/c1-17-7-4-5-15-27(17)16-6-12-24-22-19-8-2-3-9-20(19)25-21(26-22)18-10-13-23-14-11-18/h2-3,8-11,13-14,17H,4-7,12,15-16H2,1H3,(H,24,25,26)/t17-/m1/s1 |
| InChIKey | ZOPIEBLDHXABNY-QGZVFWFLSA-N |
| XLogP | 4.37 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|