C17H23N7 — CID 92734456
N-[3-[(2R)-2-methylpiperidin-1-yl]propyl]tetrazolo[5,1-a]phthalazin-6-amine (PubChem CID 92734456) has the molecular formula C17H23N7 and a molecular weight of 325.42 g/mol. Its IUPAC name is N-[3-[(2R)-2-methylpiperidin-1-yl]propyl]tetrazolo[5,1-a]phthalazin-6-amine.
| Compound Name | N-[3-[(2R)-2-methylpiperidin-1-yl]propyl]tetrazolo[5,1-a]phthalazin-6-amine |
|---|---|
| PubChem CID | 92734456 |
| Molecular Formula | C17H23N7 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | N-[3-[(2R)-2-methylpiperidin-1-yl]propyl]tetrazolo[5,1-a]phthalazin-6-amine |
| SMILES | C[C@@H]1CCCCN1CCCNc1nn2nnnc2c2ccccc12 |
| InChI | InChI=1S/C17H23N7/c1-13-7-4-5-11-23(13)12-6-10-18-16-14-8-2-3-9-15(14)17-19-21-22-24(17)20-16/h2-3,8-9,13H,4-7,10-12H2,1H3,(H,18,20)/t13-/m1/s1 |
| InChIKey | XVSYJGOQXPWQTI-CYBMUJFWSA-N |
| XLogP | 2.35 |
| TPSA | 71.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|