C23H25N7O3 — CID 133301699
1-[3-[[[6-methyl-2-(3-nitrophenyl)pyrimidin-4-yl]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide (PubChem CID 133301699) has the molecular formula C23H25N7O3 and a molecular weight of 447.50 g/mol. Its IUPAC name is 1-[3-[[[6-methyl-2-(3-nitrophenyl)pyrimidin-4-yl]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide.
| Compound Name | 1-[3-[[[6-methyl-2-(3-nitrophenyl)pyrimidin-4-yl]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 133301699 |
| Molecular Formula | C23H25N7O3 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 1-[3-[[[6-methyl-2-(3-nitrophenyl)pyrimidin-4-yl]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide |
| SMILES | Cc1cc(NCc2cccnc2N2CCCC(C(N)=O)C2)nc(-c2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C23H25N7O3/c1-15-11-20(28-22(27-15)16-5-2-8-19(12-16)30(32)33)26-13-17-6-3-9-25-23(17)29-10-4-7-18(14-29)21(24)31/h2-3,5-6,8-9,11-12,18H,4,7,10,13-14H2,1H3,(H2,24,31)(H,26,27,28) |
| InChIKey | SZVAQOVHEXUDQH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 140.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|