C19H22N2O4S — CID 133302506
N-[3-(cyclohexylsulfonylmethyl)phenyl]-2-nitroaniline (PubChem CID 133302506) has the molecular formula C19H22N2O4S and a molecular weight of 374.46 g/mol. Its IUPAC name is N-[3-(cyclohexylsulfonylmethyl)phenyl]-2-nitroaniline.
| Compound Name | N-[3-(cyclohexylsulfonylmethyl)phenyl]-2-nitroaniline |
|---|---|
| PubChem CID | 133302506 |
| Molecular Formula | C19H22N2O4S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | N-[3-(cyclohexylsulfonylmethyl)phenyl]-2-nitroaniline |
| SMILES | O=[N+]([O-])c1ccccc1Nc1cccc(CS(=O)(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C19H22N2O4S/c22-21(23)19-12-5-4-11-18(19)20-16-8-6-7-15(13-16)14-26(24,25)17-9-2-1-3-10-17/h4-8,11-13,17,20H,1-3,9-10,14H2 |
| InChIKey | LKXAWYFEMRFONX-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|