C16H16FN3 — CID 133304782
6-[[2-(3-fluorophenyl)-2-methylpropyl]amino]pyridine-2-carbonitrile (PubChem CID 133304782) has the molecular formula C16H16FN3 and a molecular weight of 269.32 g/mol. Its IUPAC name is 6-[[2-(3-fluorophenyl)-2-methylpropyl]amino]pyridine-2-carbonitrile.
| Compound Name | 6-[[2-(3-fluorophenyl)-2-methylpropyl]amino]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 133304782 |
| Molecular Formula | C16H16FN3 |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 6-[[2-(3-fluorophenyl)-2-methylpropyl]amino]pyridine-2-carbonitrile |
| SMILES | CC(C)(CNc1cccc(C#N)n1)c1cccc(F)c1 |
| InChI | InChI=1S/C16H16FN3/c1-16(2,12-5-3-6-13(17)9-12)11-19-15-8-4-7-14(10-18)20-15/h3-9H,11H2,1-2H3,(H,19,20) |
| InChIKey | CBKUJEUHKMTNKN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |