C16H14FN5 — CID 133392620
6-[2-(6-fluoro-1-methylbenzimidazol-2-yl)ethylamino]pyridine-2-carbonitrile (PubChem CID 133392620) has the molecular formula C16H14FN5 and a molecular weight of 295.32 g/mol. Its IUPAC name is 6-[2-(6-fluoro-1-methylbenzimidazol-2-yl)ethylamino]pyridine-2-carbonitrile.
| Compound Name | 6-[2-(6-fluoro-1-methylbenzimidazol-2-yl)ethylamino]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 133392620 |
| Molecular Formula | C16H14FN5 |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 6-[2-(6-fluoro-1-methylbenzimidazol-2-yl)ethylamino]pyridine-2-carbonitrile |
| SMILES | Cn1c(CCNc2cccc(C#N)n2)nc2ccc(F)cc21 |
| InChI | InChI=1S/C16H14FN5/c1-22-14-9-11(17)5-6-13(14)21-16(22)7-8-19-15-4-2-3-12(10-18)20-15/h2-6,9H,7-8H2,1H3,(H,19,20) |
| InChIKey | RSMWPNAMYZEYJV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 66.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |