C17H24F2N2O3S — CID 133305587
1-[4-[4-(difluoromethylsulfonyl)anilino]piperidin-1-yl]-3-methylbutan-1-one (PubChem CID 133305587) has the molecular formula C17H24F2N2O3S and a molecular weight of 374.45 g/mol. Its IUPAC name is 1-[4-[4-(difluoromethylsulfonyl)anilino]piperidin-1-yl]-3-methylbutan-1-one.
| Compound Name | 1-[4-[4-(difluoromethylsulfonyl)anilino]piperidin-1-yl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 133305587 |
| Molecular Formula | C17H24F2N2O3S |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 1-[4-[4-(difluoromethylsulfonyl)anilino]piperidin-1-yl]-3-methylbutan-1-one |
| SMILES | CC(C)CC(=O)N1CCC(Nc2ccc(S(=O)(=O)C(F)F)cc2)CC1 |
| InChI | InChI=1S/C17H24F2N2O3S/c1-12(2)11-16(22)21-9-7-14(8-10-21)20-13-3-5-15(6-4-13)25(23,24)17(18)19/h3-6,12,14,17,20H,7-11H2,1-2H3 |
| InChIKey | UTEQMOUINXQACL-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |