C19H21N3O5S2 — CID 133307345
4-[3-nitro-4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)phenyl]sulfonylmorpholine (PubChem CID 133307345) has the molecular formula C19H21N3O5S2 and a molecular weight of 435.53 g/mol. Its IUPAC name is 4-[3-nitro-4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)phenyl]sulfonylmorpholine.
| Compound Name | 4-[3-nitro-4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)phenyl]sulfonylmorpholine |
|---|---|
| PubChem CID | 133307345 |
| Molecular Formula | C19H21N3O5S2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | 4-[3-nitro-4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)phenyl]sulfonylmorpholine |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)N2CCOCC2)ccc1N1CC=C(c2cccs2)CC1 |
| InChI | InChI=1S/C19H21N3O5S2/c23-22(24)18-14-16(29(25,26)21-9-11-27-12-10-21)3-4-17(18)20-7-5-15(6-8-20)19-2-1-13-28-19/h1-5,13-14H,6-12H2 |
| InChIKey | HTPKPTAMGZTENS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|