C23H24ClN3O3 — CID 133307989
[4-[(1-chloroisoquinolin-3-yl)amino]piperidin-1-yl]-(3,4-dimethoxyphenyl)methanone (PubChem CID 133307989) has the molecular formula C23H24ClN3O3 and a molecular weight of 425.92 g/mol. Its IUPAC name is [4-[(1-chloroisoquinolin-3-yl)amino]piperidin-1-yl]-(3,4-dimethoxyphenyl)methanone.
| Compound Name | [4-[(1-chloroisoquinolin-3-yl)amino]piperidin-1-yl]-(3,4-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 133307989 |
| Molecular Formula | C23H24ClN3O3 |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | [4-[(1-chloroisoquinolin-3-yl)amino]piperidin-1-yl]-(3,4-dimethoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)N2CCC(Nc3cc4ccccc4c(Cl)n3)CC2)cc1OC |
| InChI | InChI=1S/C23H24ClN3O3/c1-29-19-8-7-16(13-20(19)30-2)23(28)27-11-9-17(10-12-27)25-21-14-15-5-3-4-6-18(15)22(24)26-21/h3-8,13-14,17H,9-12H2,1-2H3,(H,25,26) |
| InChIKey | AZUAIMDFIKRIAU-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|