C15H22FN3O3 — CID 133315363
3-[[1-(4-fluoro-2-nitrophenyl)piperidin-4-yl]-methylamino]propan-1-ol (PubChem CID 133315363) has the molecular formula C15H22FN3O3 and a molecular weight of 311.36 g/mol. Its IUPAC name is 3-[[1-(4-fluoro-2-nitrophenyl)piperidin-4-yl]-methylamino]propan-1-ol.
| Compound Name | 3-[[1-(4-fluoro-2-nitrophenyl)piperidin-4-yl]-methylamino]propan-1-ol |
|---|---|
| PubChem CID | 133315363 |
| Molecular Formula | C15H22FN3O3 |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 3-[[1-(4-fluoro-2-nitrophenyl)piperidin-4-yl]-methylamino]propan-1-ol |
| SMILES | CN(CCCO)C1CCN(c2ccc(F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C15H22FN3O3/c1-17(7-2-10-20)13-5-8-18(9-6-13)14-4-3-12(16)11-15(14)19(21)22/h3-4,11,13,20H,2,5-10H2,1H3 |
| InChIKey | YAXUNPLYPUKEJQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 69.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|