C15H20FN3O3 — CID 54118542
[(7R,9aS)-2-(4-fluoro-2-nitrophenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methanol (PubChem CID 54118542) has the molecular formula C15H20FN3O3 and a molecular weight of 309.34 g/mol. Its IUPAC name is [(7R,9aS)-2-(4-fluoro-2-nitrophenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methanol.
| Compound Name | [(7R,9aS)-2-(4-fluoro-2-nitrophenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methanol |
|---|---|
| PubChem CID | 54118542 |
| Molecular Formula | C15H20FN3O3 |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | [(7R,9aS)-2-(4-fluoro-2-nitrophenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methanol |
| SMILES | O=[N+]([O-])c1cc(F)ccc1N1CCN2C[C@H](CO)CC[C@H]2C1 |
| InChI | InChI=1S/C15H20FN3O3/c16-12-2-4-14(15(7-12)19(21)22)18-6-5-17-8-11(10-20)1-3-13(17)9-18/h2,4,7,11,13,20H,1,3,5-6,8-10H2/t11-,13+/m1/s1 |
| InChIKey | NMALBXWNQSOIAP-YPMHNXCESA-N |
| XLogP | 1.63 |
| TPSA | 69.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|