C14H23N5 — CID 133315581
2-[4-(1-methylpiperidin-3-yl)piperazin-1-yl]pyrazine (PubChem CID 133315581) has the molecular formula C14H23N5 and a molecular weight of 261.37 g/mol. Its IUPAC name is 2-[4-(1-methylpiperidin-3-yl)piperazin-1-yl]pyrazine.
| Compound Name | 2-[4-(1-methylpiperidin-3-yl)piperazin-1-yl]pyrazine |
|---|---|
| PubChem CID | 133315581 |
| Molecular Formula | C14H23N5 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.20 |
| IUPAC Name | 2-[4-(1-methylpiperidin-3-yl)piperazin-1-yl]pyrazine |
| SMILES | CN1CCCC(N2CCN(c3cnccn3)CC2)C1 |
| InChI | InChI=1S/C14H23N5/c1-17-6-2-3-13(12-17)18-7-9-19(10-8-18)14-11-15-4-5-16-14/h4-5,11,13H,2-3,6-10,12H2,1H3 |
| InChIKey | CJFUCUWRCMAGEH-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |