C19H20ClN3O — CID 133317873
N-[3-[(2-chloro-6-cyanoanilino)methyl]phenyl]-2-methylbutanamide (PubChem CID 133317873) has the molecular formula C19H20ClN3O and a molecular weight of 341.84 g/mol. Its IUPAC name is N-[3-[(2-chloro-6-cyanoanilino)methyl]phenyl]-2-methylbutanamide.
| Compound Name | N-[3-[(2-chloro-6-cyanoanilino)methyl]phenyl]-2-methylbutanamide |
|---|---|
| PubChem CID | 133317873 |
| Molecular Formula | C19H20ClN3O |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | N-[3-[(2-chloro-6-cyanoanilino)methyl]phenyl]-2-methylbutanamide |
| SMILES | CCC(C)C(=O)Nc1cccc(CNc2c(Cl)cccc2C#N)c1 |
| InChI | InChI=1S/C19H20ClN3O/c1-3-13(2)19(24)23-16-8-4-6-14(10-16)12-22-18-15(11-21)7-5-9-17(18)20/h4-10,13,22H,3,12H2,1-2H3,(H,23,24) |
| InChIKey | DYNFGRORPOIZBB-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |