C16H21N5O — CID 133320073
4-(3-methyl-1,2,4-oxadiazol-5-yl)-N-(1-prop-2-enylpiperidin-4-yl)pyridin-2-amine (PubChem CID 133320073) has the molecular formula C16H21N5O and a molecular weight of 299.38 g/mol. Its IUPAC name is 4-(3-methyl-1,2,4-oxadiazol-5-yl)-N-(1-prop-2-enylpiperidin-4-yl)pyridin-2-amine.
| Compound Name | 4-(3-methyl-1,2,4-oxadiazol-5-yl)-N-(1-prop-2-enylpiperidin-4-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 133320073 |
| Molecular Formula | C16H21N5O |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 4-(3-methyl-1,2,4-oxadiazol-5-yl)-N-(1-prop-2-enylpiperidin-4-yl)pyridin-2-amine |
| SMILES | C=CCN1CCC(Nc2cc(-c3nc(C)no3)ccn2)CC1 |
| InChI | InChI=1S/C16H21N5O/c1-3-8-21-9-5-14(6-10-21)19-15-11-13(4-7-17-15)16-18-12(2)20-22-16/h3-4,7,11,14H,1,5-6,8-10H2,2H3,(H,17,19) |
| InChIKey | AECRFOLKHWAPQI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 67.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|