C24H25N5O — CID 133320910
1-[[3-[[(3-cyanoquinolin-4-yl)amino]methyl]phenyl]methyl]piperidine-3-carboxamide (PubChem CID 133320910) has the molecular formula C24H25N5O and a molecular weight of 399.50 g/mol. Its IUPAC name is 1-[[3-[[(3-cyanoquinolin-4-yl)amino]methyl]phenyl]methyl]piperidine-3-carboxamide.
| Compound Name | 1-[[3-[[(3-cyanoquinolin-4-yl)amino]methyl]phenyl]methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 133320910 |
| Molecular Formula | C24H25N5O |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | 1-[[3-[[(3-cyanoquinolin-4-yl)amino]methyl]phenyl]methyl]piperidine-3-carboxamide |
| SMILES | N#Cc1cnc2ccccc2c1NCc1cccc(CN2CCCC(C(N)=O)C2)c1 |
| InChI | InChI=1S/C24H25N5O/c25-12-20-14-27-22-9-2-1-8-21(22)23(20)28-13-17-5-3-6-18(11-17)15-29-10-4-7-19(16-29)24(26)30/h1-3,5-6,8-9,11,14,19H,4,7,10,13,15-16H2,(H2,26,30)(H,27,28) |
| InChIKey | GOPYMQUBOUYTPW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 95.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |