C20H23N5O — CID 97160993
(3R)-1-[[3-[[(4-cyano-3-pyridinyl)amino]methyl]phenyl]methyl]piperidine-3-carboxamide (PubChem CID 97160993) has the molecular formula C20H23N5O and a molecular weight of 349.44 g/mol. Its IUPAC name is (3R)-1-[[3-[[(4-cyano-3-pyridinyl)amino]methyl]phenyl]methyl]piperidine-3-carboxamide.
| Compound Name | (3R)-1-[[3-[[(4-cyano-3-pyridinyl)amino]methyl]phenyl]methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 97160993 |
| Molecular Formula | C20H23N5O |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | (3R)-1-[[3-[[(4-cyano-3-pyridinyl)amino]methyl]phenyl]methyl]piperidine-3-carboxamide |
| SMILES | N#Cc1ccncc1NCc1cccc(CN2CCC[C@@H](C(N)=O)C2)c1 |
| InChI | InChI=1S/C20H23N5O/c21-10-17-6-7-23-12-19(17)24-11-15-3-1-4-16(9-15)13-25-8-2-5-18(14-25)20(22)26/h1,3-4,6-7,9,12,18,24H,2,5,8,11,13-14H2,(H2,22,26)/t18-/m1/s1 |
| InChIKey | WSHQKPQPVOMVFP-GOSISDBHSA-N |
| XLogP | 2.26 |
| TPSA | 95.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |