C19H23Cl2N3O — CID 133321390
[1-(6-chloro-5-ethyl-2-methylpyrimidin-4-yl)piperidin-4-yl]-(4-chlorophenyl)methanol (PubChem CID 133321390) has the molecular formula C19H23Cl2N3O and a molecular weight of 380.32 g/mol. Its IUPAC name is [1-(6-chloro-5-ethyl-2-methylpyrimidin-4-yl)piperidin-4-yl]-(4-chlorophenyl)methanol.
| Compound Name | [1-(6-chloro-5-ethyl-2-methylpyrimidin-4-yl)piperidin-4-yl]-(4-chlorophenyl)methanol |
|---|---|
| PubChem CID | 133321390 |
| Molecular Formula | C19H23Cl2N3O |
| Molecular Weight | 380.32 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | [1-(6-chloro-5-ethyl-2-methylpyrimidin-4-yl)piperidin-4-yl]-(4-chlorophenyl)methanol |
| SMILES | CCc1c(Cl)nc(C)nc1N1CCC(C(O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C19H23Cl2N3O/c1-3-16-18(21)22-12(2)23-19(16)24-10-8-14(9-11-24)17(25)13-4-6-15(20)7-5-13/h4-7,14,17,25H,3,8-11H2,1-2H3 |
| InChIKey | JUMNBQJZUKNIAA-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.32 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |