C16H20ClN3O2 — CID 133321810
2-[(6-chloro-5-ethyl-2-methylpyrimidin-4-yl)amino]-1-(3-methoxyphenyl)ethanol (PubChem CID 133321810) has the molecular formula C16H20ClN3O2 and a molecular weight of 321.81 g/mol. Its IUPAC name is 2-[(6-chloro-5-ethyl-2-methylpyrimidin-4-yl)amino]-1-(3-methoxyphenyl)ethanol.
| Compound Name | 2-[(6-chloro-5-ethyl-2-methylpyrimidin-4-yl)amino]-1-(3-methoxyphenyl)ethanol |
|---|---|
| PubChem CID | 133321810 |
| Molecular Formula | C16H20ClN3O2 |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 2-[(6-chloro-5-ethyl-2-methylpyrimidin-4-yl)amino]-1-(3-methoxyphenyl)ethanol |
| SMILES | CCc1c(Cl)nc(C)nc1NCC(O)c1cccc(OC)c1 |
| InChI | InChI=1S/C16H20ClN3O2/c1-4-13-15(17)19-10(2)20-16(13)18-9-14(21)11-6-5-7-12(8-11)22-3/h5-8,14,21H,4,9H2,1-3H3,(H,18,19,20) |
| InChIKey | VEEIJFQTIMLUBK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |