C16H20ClN3O — CID 133375786
2-[(6-chloro-2-ethyl-5-methylpyrimidin-4-yl)amino]-1-(3-methylphenyl)ethanol (PubChem CID 133375786) has the molecular formula C16H20ClN3O and a molecular weight of 305.81 g/mol. Its IUPAC name is 2-[(6-chloro-2-ethyl-5-methylpyrimidin-4-yl)amino]-1-(3-methylphenyl)ethanol.
| Compound Name | 2-[(6-chloro-2-ethyl-5-methylpyrimidin-4-yl)amino]-1-(3-methylphenyl)ethanol |
|---|---|
| PubChem CID | 133375786 |
| Molecular Formula | C16H20ClN3O |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 2-[(6-chloro-2-ethyl-5-methylpyrimidin-4-yl)amino]-1-(3-methylphenyl)ethanol |
| SMILES | CCc1nc(Cl)c(C)c(NCC(O)c2cccc(C)c2)n1 |
| InChI | InChI=1S/C16H20ClN3O/c1-4-14-19-15(17)11(3)16(20-14)18-9-13(21)12-7-5-6-10(2)8-12/h5-8,13,21H,4,9H2,1-3H3,(H,18,19,20) |
| InChIKey | WHELYFZXJOZYEI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |