C15H19F3N4 — CID 133322827
2-(1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-N,N-dimethyl-6-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 133322827) has the molecular formula C15H19F3N4 and a molecular weight of 312.34 g/mol. Its IUPAC name is 2-(1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-N,N-dimethyl-6-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | 2-(1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-N,N-dimethyl-6-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 133322827 |
| Molecular Formula | C15H19F3N4 |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 2-(1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-N,N-dimethyl-6-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | CN(C)c1cc(C(F)(F)F)nc(N2CC3CC=CCC3C2)n1 |
| InChI | InChI=1S/C15H19F3N4/c1-21(2)13-7-12(15(16,17)18)19-14(20-13)22-8-10-5-3-4-6-11(10)9-22/h3-4,7,10-11H,5-6,8-9H2,1-2H3 |
| InChIKey | ULGHXBIITFWTOK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|