C16H19F3N4 — CID 145433346
4-[6-pyrrolidin-1-yl-2-(trifluoromethyl)pyrimidin-4-yl]cyclohexane-1-carbonitrile (PubChem CID 145433346) has the molecular formula C16H19F3N4 and a molecular weight of 324.35 g/mol. Its IUPAC name is 4-[6-pyrrolidin-1-yl-2-(trifluoromethyl)pyrimidin-4-yl]cyclohexane-1-carbonitrile.
| Compound Name | 4-[6-pyrrolidin-1-yl-2-(trifluoromethyl)pyrimidin-4-yl]cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 145433346 |
| Molecular Formula | C16H19F3N4 |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 4-[6-pyrrolidin-1-yl-2-(trifluoromethyl)pyrimidin-4-yl]cyclohexane-1-carbonitrile |
| SMILES | N#CC1CCC(c2cc(N3CCCC3)nc(C(F)(F)F)n2)CC1 |
| InChI | InChI=1S/C16H19F3N4/c17-16(18,19)15-21-13(12-5-3-11(10-20)4-6-12)9-14(22-15)23-7-1-2-8-23/h9,11-12H,1-8H2 |
| InChIKey | SRTPRQHBYXEWIO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 52.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |