C17H18N4O — CID 133327846
6-[2-(furan-2-yl)-4-methylpiperidin-1-yl]pyrido[2,3-b]pyrazine (PubChem CID 133327846) has the molecular formula C17H18N4O and a molecular weight of 294.36 g/mol. Its IUPAC name is 6-[2-(furan-2-yl)-4-methylpiperidin-1-yl]pyrido[2,3-b]pyrazine.
| Compound Name | 6-[2-(furan-2-yl)-4-methylpiperidin-1-yl]pyrido[2,3-b]pyrazine |
|---|---|
| PubChem CID | 133327846 |
| Molecular Formula | C17H18N4O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 6-[2-(furan-2-yl)-4-methylpiperidin-1-yl]pyrido[2,3-b]pyrazine |
| SMILES | CC1CCN(c2ccc3nccnc3n2)C(c2ccco2)C1 |
| InChI | InChI=1S/C17H18N4O/c1-12-6-9-21(14(11-12)15-3-2-10-22-15)16-5-4-13-17(20-16)19-8-7-18-13/h2-5,7-8,10,12,14H,6,9,11H2,1H3 |
| InChIKey | OKRVCJWVHHFZNJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 55.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |