C13H16N4S — CID 133309139
2,3-dimethyl-4-pyrido[2,3-b]pyrazin-6-ylthiomorpholine (PubChem CID 133309139) has the molecular formula C13H16N4S and a molecular weight of 260.37 g/mol. Its IUPAC name is 2,3-dimethyl-4-pyrido[2,3-b]pyrazin-6-ylthiomorpholine.
| Compound Name | 2,3-dimethyl-4-pyrido[2,3-b]pyrazin-6-ylthiomorpholine |
|---|---|
| PubChem CID | 133309139 |
| Molecular Formula | C13H16N4S |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 2,3-dimethyl-4-pyrido[2,3-b]pyrazin-6-ylthiomorpholine |
| SMILES | CC1SCCN(c2ccc3nccnc3n2)C1C |
| InChI | InChI=1S/C13H16N4S/c1-9-10(2)18-8-7-17(9)12-4-3-11-13(16-12)15-6-5-14-11/h3-6,9-10H,7-8H2,1-2H3 |
| InChIKey | CAJUYOGZFLDYAT-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |