C16H21ClN4O — CID 133332656
4-chloro-6-[2-(5-ethylfuran-2-yl)-4-methylpiperidin-1-yl]pyrimidin-2-amine (PubChem CID 133332656) has the molecular formula C16H21ClN4O and a molecular weight of 320.82 g/mol. Its IUPAC name is 4-chloro-6-[2-(5-ethylfuran-2-yl)-4-methylpiperidin-1-yl]pyrimidin-2-amine.
| Compound Name | 4-chloro-6-[2-(5-ethylfuran-2-yl)-4-methylpiperidin-1-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 133332656 |
| Molecular Formula | C16H21ClN4O |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 4-chloro-6-[2-(5-ethylfuran-2-yl)-4-methylpiperidin-1-yl]pyrimidin-2-amine |
| SMILES | CCc1ccc(C2CC(C)CCN2c2cc(Cl)nc(N)n2)o1 |
| InChI | InChI=1S/C16H21ClN4O/c1-3-11-4-5-13(22-11)12-8-10(2)6-7-21(12)15-9-14(17)19-16(18)20-15/h4-5,9-10,12H,3,6-8H2,1-2H3,(H2,18,19,20) |
| InChIKey | JJZOYSUQXMASCM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |