C17H21N3O3 — CID 96996561
2-[(2S,4S)-2-(5-ethylfuran-2-yl)-4-methylpiperidin-1-yl]-3-nitropyridine (PubChem CID 96996561) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is 2-[(2S,4S)-2-(5-ethylfuran-2-yl)-4-methylpiperidin-1-yl]-3-nitropyridine.
| Compound Name | 2-[(2S,4S)-2-(5-ethylfuran-2-yl)-4-methylpiperidin-1-yl]-3-nitropyridine |
|---|---|
| PubChem CID | 96996561 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 2-[(2S,4S)-2-(5-ethylfuran-2-yl)-4-methylpiperidin-1-yl]-3-nitropyridine |
| SMILES | CCc1ccc([C@@H]2C[C@@H](C)CCN2c2ncccc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C17H21N3O3/c1-3-13-6-7-16(23-13)15-11-12(2)8-10-19(15)17-14(20(21)22)5-4-9-18-17/h4-7,9,12,15H,3,8,10-11H2,1-2H3/t12-,15-/m0/s1 |
| InChIKey | WENGAHUEUSCZLE-WFASDCNBSA-N |
| XLogP | 4.12 |
| TPSA | 72.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|