C20H26N3O5- — CID 170423261
ethoxy-[2-[2-(5-ethylfuran-2-yl)-4-methylpiperidin-1-yl]-3-nitro-1H-pyridin-4-ylidene]methanolate (PubChem CID 170423261) has the molecular formula C20H26N3O5- and a molecular weight of 388.44 g/mol. Its IUPAC name is ethoxy-[2-[2-(5-ethylfuran-2-yl)-4-methylpiperidin-1-yl]-3-nitro-1H-pyridin-4-ylidene]methanolate.
| Compound Name | ethoxy-[2-[2-(5-ethylfuran-2-yl)-4-methylpiperidin-1-yl]-3-nitro-1H-pyridin-4-ylidene]methanolate |
|---|---|
| PubChem CID | 170423261 |
| Molecular Formula | C20H26N3O5- |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | ethoxy-[2-[2-(5-ethylfuran-2-yl)-4-methylpiperidin-1-yl]-3-nitro-1H-pyridin-4-ylidene]methanolate |
| SMILES | CCOC([O-])=C1C=CNC(N2CCC(C)CC2c2ccc(CC)o2)=C1[N+](=O)[O-] |
| InChI | InChI=1S/C20H27N3O5/c1-4-14-6-7-17(28-14)16-12-13(3)9-11-22(16)19-18(23(25)26)15(8-10-21-19)20(24)27-5-2/h6-8,10,13,16,21,24H,4-5,9,11-12H2,1-3H3/p-1 |
| InChIKey | RXSZVSGJQTTWDN-UHFFFAOYSA-M |
| XLogP | 2.79 |
| TPSA | 103.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|