C12H16N4O2S2 — CID 133335037
N-[2-[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]ethyl]benzenesulfonamide (PubChem CID 133335037) has the molecular formula C12H16N4O2S2 and a molecular weight of 312.42 g/mol. Its IUPAC name is N-[2-[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]ethyl]benzenesulfonamide.
| Compound Name | N-[2-[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 133335037 |
| Molecular Formula | C12H16N4O2S2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | N-[2-[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]ethyl]benzenesulfonamide |
| SMILES | CCc1nsc(NCCNS(=O)(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C12H16N4O2S2/c1-2-11-15-12(19-16-11)13-8-9-14-20(17,18)10-6-4-3-5-7-10/h3-7,14H,2,8-9H2,1H3,(H,13,15,16) |
| InChIKey | RCVZGECYZSKTIG-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|