C16H15F4N3O2 — CID 133338780
N,N-dimethyl-2-[3-[[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]methyl]phenoxy]acetamide (PubChem CID 133338780) has the molecular formula C16H15F4N3O2 and a molecular weight of 357.31 g/mol. Its IUPAC name is N,N-dimethyl-2-[3-[[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]methyl]phenoxy]acetamide.
| Compound Name | N,N-dimethyl-2-[3-[[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 133338780 |
| Molecular Formula | C16H15F4N3O2 |
| Molecular Weight | 357.31 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | N,N-dimethyl-2-[3-[[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]methyl]phenoxy]acetamide |
| SMILES | CN(C)C(=O)COc1cccc(CNc2c(F)c(F)nc(F)c2F)c1 |
| InChI | InChI=1S/C16H15F4N3O2/c1-23(2)11(24)8-25-10-5-3-4-9(6-10)7-21-14-12(17)15(19)22-16(20)13(14)18/h3-6H,7-8H2,1-2H3,(H,21,22) |
| InChIKey | PMJWYPLCPIVUIR-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|