C16H18N4O4 — CID 122053124
5-[[3-[2-(dimethylamino)-2-oxoethoxy]phenyl]methylamino]pyrazine-2-carboxylic acid (PubChem CID 122053124) has the molecular formula C16H18N4O4 and a molecular weight of 330.34 g/mol. Its IUPAC name is 5-[[3-[2-(dimethylamino)-2-oxoethoxy]phenyl]methylamino]pyrazine-2-carboxylic acid.
| Compound Name | 5-[[3-[2-(dimethylamino)-2-oxoethoxy]phenyl]methylamino]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 122053124 |
| Molecular Formula | C16H18N4O4 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 5-[[3-[2-(dimethylamino)-2-oxoethoxy]phenyl]methylamino]pyrazine-2-carboxylic acid |
| SMILES | CN(C)C(=O)COc1cccc(CNc2cnc(C(=O)O)cn2)c1 |
| InChI | InChI=1S/C16H18N4O4/c1-20(2)15(21)10-24-12-5-3-4-11(6-12)7-18-14-9-17-13(8-19-14)16(22)23/h3-6,8-9H,7,10H2,1-2H3,(H,18,19)(H,22,23) |
| InChIKey | DVANDINJVGENLE-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |