C12H7ClN4O3S2 — CID 133340277
2-(5-chlorothiophen-2-yl)-5-[(4-methyl-5-nitro-2-pyridinyl)sulfanyl]-1,3,4-oxadiazole (PubChem CID 133340277) has the molecular formula C12H7ClN4O3S2 and a molecular weight of 354.80 g/mol. Its IUPAC name is 2-(5-chlorothiophen-2-yl)-5-[(4-methyl-5-nitro-2-pyridinyl)sulfanyl]-1,3,4-oxadiazole.
| Compound Name | 2-(5-chlorothiophen-2-yl)-5-[(4-methyl-5-nitro-2-pyridinyl)sulfanyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 133340277 |
| Molecular Formula | C12H7ClN4O3S2 |
| Molecular Weight | 354.80 g/mol |
| Exact Mass | 353.96 |
| IUPAC Name | 2-(5-chlorothiophen-2-yl)-5-[(4-methyl-5-nitro-2-pyridinyl)sulfanyl]-1,3,4-oxadiazole |
| SMILES | Cc1cc(Sc2nnc(-c3ccc(Cl)s3)o2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H7ClN4O3S2/c1-6-4-10(14-5-7(6)17(18)19)22-12-16-15-11(20-12)8-2-3-9(13)21-8/h2-5H,1H3 |
| InChIKey | WXXUAMDEZAYUNF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 94.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.80 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|